About butylurea;silicic acid
butylurea;silicic acid (PubChem CID 86735760) has the molecular formula C5H16N2O5Si
and a molecular weight of 212.28 g/mol. Its IUPAC name is butylurea;silicic acid.
Molecular Properties
| Compound Name | butylurea;silicic acid |
| PubChem CID | 86735760 |
| Molecular Formula | C5H16N2O5Si |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | butylurea;silicic acid |
| SMILES | CCCCNC(N)=O.O[Si](O)(O)O |
| InChI | InChI=1S/C5H12N2O.H4O4Si/c1-2-3-4-7-5(6)8;1-5(2,3)4/h2-4H2,1H3,(H3,6,7,8);1-4H |
| InChIKey | GYWGUUBWKWUWAU-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butylurea;silicic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylurea;silicic acid?
The IUPAC name of butylurea;silicic acid (CID 86735760) is butylurea;silicic acid.
What is the SMILES notation for butylurea;silicic acid?
The canonical SMILES for butylurea;silicic acid is CCCCNC(N)=O.O[Si](O)(O)O.
What is the InChIKey of butylurea;silicic acid?
The InChIKey is GYWGUUBWKWUWAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O.H4O4Si/c1-2-3-4-7-5(6)8;1-5(2,3)4/h2-4H2,1H3,(H3,6,7,8);1-4H.
What are the key properties of butylurea;silicic acid?
butylurea;silicic acid has a molecular weight of 212.28 g/mol, XLogP of -2.15, 3 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butylurea;silicic acid is sourced from PubChem (CID 86735760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).