About 3-chloropropylurea
3-chloropropylurea (PubChem CID 6421120) has the molecular formula C4H9ClN2O
and a molecular weight of 136.58 g/mol. Its IUPAC name is 3-chloropropylurea.
Molecular Properties
| Compound Name | 3-chloropropylurea |
| PubChem CID | 6421120 |
| Molecular Formula | C4H9ClN2O |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 3-chloropropylurea |
| SMILES | NC(=O)NCCCCl |
| InChI | InChI=1S/C4H9ClN2O/c5-2-1-3-7-4(6)8/h1-3H2,(H3,6,7,8) |
| InChIKey | XRRCUWHNUSUVGY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropylurea?
The IUPAC name of 3-chloropropylurea (CID 6421120) is 3-chloropropylurea.
What is the SMILES notation for 3-chloropropylurea?
The canonical SMILES for 3-chloropropylurea is NC(=O)NCCCCl.
What is the InChIKey of 3-chloropropylurea?
The InChIKey is XRRCUWHNUSUVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9ClN2O/c5-2-1-3-7-4(6)8/h1-3H2,(H3,6,7,8).
What are the key properties of 3-chloropropylurea?
3-chloropropylurea has a molecular weight of 136.58 g/mol, XLogP of 0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropylurea is sourced from PubChem (CID 6421120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).