About 12-hydroxydodecylurea
12-hydroxydodecylurea (PubChem CID 57265418) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 12-hydroxydodecylurea.
Molecular Properties
| Compound Name | 12-hydroxydodecylurea |
| PubChem CID | 57265418 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 12-hydroxydodecylurea |
| SMILES | NC(=O)NCCCCCCCCCCCCO |
| InChI | InChI=1S/C13H28N2O2/c14-13(17)15-11-9-7-5-3-1-2-4-6-8-10-12-16/h16H,1-12H2,(H3,14,15,17) |
| InChIKey | QTGJJBQJSVPHBM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-hydroxydodecylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-hydroxydodecylurea?
The IUPAC name of 12-hydroxydodecylurea (CID 57265418) is 12-hydroxydodecylurea.
What is the SMILES notation for 12-hydroxydodecylurea?
The canonical SMILES for 12-hydroxydodecylurea is NC(=O)NCCCCCCCCCCCCO.
What is the InChIKey of 12-hydroxydodecylurea?
The InChIKey is QTGJJBQJSVPHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2/c14-13(17)15-11-9-7-5-3-1-2-4-6-8-10-12-16/h16H,1-12H2,(H3,14,15,17).
What are the key properties of 12-hydroxydodecylurea?
12-hydroxydodecylurea has a molecular weight of 244.38 g/mol, XLogP of 2.55, 12 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-hydroxydodecylurea is sourced from PubChem (CID 57265418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).