About CID 162306513
CID 162306513 (PubChem CID 162306513) has the molecular formula C5H11NNaO3
and a molecular weight of 156.14 g/mol.
Molecular Properties
| Compound Name | CID 162306513 |
| PubChem CID | 162306513 |
| Molecular Formula | C5H11NNaO3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | — |
| SMILES | O=C(O)NCCCCO.[Na] |
| InChI | InChI=1S/C5H11NO3.Na/c7-4-2-1-3-6-5(8)9;/h6-7H,1-4H2,(H,8,9); |
| InChIKey | KXQOPYXFUYQQMM-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 162306513 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162306513?
The IUPAC name of CID 162306513 (CID 162306513) is not available.
What is the SMILES notation for CID 162306513?
The canonical SMILES for CID 162306513 is O=C(O)NCCCCO.[Na].
What is the InChIKey of CID 162306513?
The InChIKey is KXQOPYXFUYQQMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3.Na/c7-4-2-1-3-6-5(8)9;/h6-7H,1-4H2,(H,8,9);.
What are the key properties of CID 162306513?
CID 162306513 has a molecular weight of 156.14 g/mol, XLogP of -0.35, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162306513 is sourced from PubChem (CID 162306513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).