About 3-aminopropylcarbamic acid
3-aminopropylcarbamic acid (PubChem CID 3023499) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 3-aminopropylcarbamic acid.
Molecular Properties
| Compound Name | 3-aminopropylcarbamic acid |
| PubChem CID | 3023499 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 3-aminopropylcarbamic acid |
| SMILES | NCCCNC(=O)O |
| InChI | InChI=1S/C4H10N2O2/c5-2-1-3-6-4(7)8/h6H,1-3,5H2,(H,7,8) |
| InChIKey | JLZOGLJEROCEQF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropylcarbamic acid?
The IUPAC name of 3-aminopropylcarbamic acid (CID 3023499) is 3-aminopropylcarbamic acid.
What is the SMILES notation for 3-aminopropylcarbamic acid?
The canonical SMILES for 3-aminopropylcarbamic acid is NCCCNC(=O)O.
What is the InChIKey of 3-aminopropylcarbamic acid?
The InChIKey is JLZOGLJEROCEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c5-2-1-3-6-4(7)8/h6H,1-3,5H2,(H,7,8).
What are the key properties of 3-aminopropylcarbamic acid?
3-aminopropylcarbamic acid has a molecular weight of 118.14 g/mol, XLogP of -0.40, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropylcarbamic acid is sourced from PubChem (CID 3023499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).