4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid

C9H18N2O3 — CID 56942187

IUPAC4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(C(=O)O)C(C)C(=O)NCCCN
InChIInChI=1S/C9H18N2O3/c1-6(7(2)9(13)14)8(12)11-5-3-4-10/h6-7H,3-5,10H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyXLCLRUDXOUIGJA-UHFFFAOYSA-N
MW202.25 g/mol
LogP-0.19
Rot. Bonds6

About 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid

4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 56942187) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID56942187
Molecular FormulaC9H18N2O3
Molecular Weight202.25 g/mol
Exact Mass202.13
IUPAC Name4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCC(C(=O)O)C(C)C(=O)NCCCN
InChIInChI=1S/C9H18N2O3/c1-6(7(2)9(13)14)8(12)11-5-3-4-10/h6-7H,3-5,10H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyXLCLRUDXOUIGJA-UHFFFAOYSA-N
XLogP-0.19
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.25
LogP ≤ 5-0.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid (CID 56942187) is 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid is CC(C(=O)O)C(C)C(=O)NCCCN.
What is the InChIKey of 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is XLCLRUDXOUIGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3/c1-6(7(2)9(13)14)8(12)11-5-3-4-10/h6-7H,3-5,10H2,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid?
4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 202.25 g/mol, XLogP of -0.19, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-aminopropylamino)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 56942187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).