C11H22N2O3 — CID 103498046
4-[3-(ethylamino)propylamino]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103498046) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[3-(ethylamino)propylamino]-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[3-(ethylamino)propylamino]-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103498046 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 4-[3-(ethylamino)propylamino]-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CCNCCCNC(=O)C(C)C(C)C(=O)O |
| InChI | InChI=1S/C11H22N2O3/c1-4-12-6-5-7-13-10(14)8(2)9(3)11(15)16/h8-9,12H,4-7H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | HHMNAVRSDIGKSD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|