C11H23N3O3 — CID 79010343
(2R)-2-[3-(ethylamino)propylcarbamoylamino]-3-methylbutanoic acid (PubChem CID 79010343) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2R)-2-[3-(ethylamino)propylcarbamoylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[3-(ethylamino)propylcarbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79010343 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | (2R)-2-[3-(ethylamino)propylcarbamoylamino]-3-methylbutanoic acid |
| SMILES | CCNCCCNC(=O)N[C@@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C11H23N3O3/c1-4-12-6-5-7-13-11(17)14-9(8(2)3)10(15)16/h8-9,12H,4-7H2,1-3H3,(H,15,16)(H2,13,14,17)/t9-/m1/s1 |
| InChIKey | KJQXOYRUEUPOHX-SECBINFHSA-N |
| XLogP | 0.39 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|