C10H21N3O5S — CID 113363904
(2S)-2-[2-(ethylsulfamoyl)ethylcarbamoylamino]-3-methylbutanoic acid (PubChem CID 113363904) has the molecular formula C10H21N3O5S and a molecular weight of 295.36 g/mol. Its IUPAC name is (2S)-2-[2-(ethylsulfamoyl)ethylcarbamoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[2-(ethylsulfamoyl)ethylcarbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 113363904 |
| Molecular Formula | C10H21N3O5S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2S)-2-[2-(ethylsulfamoyl)ethylcarbamoylamino]-3-methylbutanoic acid |
| SMILES | CCNS(=O)(=O)CCNC(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C10H21N3O5S/c1-4-12-19(17,18)6-5-11-10(16)13-8(7(2)3)9(14)15/h7-8,12H,4-6H2,1-3H3,(H,14,15)(H2,11,13,16)/t8-/m0/s1 |
| InChIKey | XHUJSFOGWQYWFU-QMMMGPOBSA-N |
| XLogP | -0.67 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |