C9H18N2O6S — CID 114111684
2-(2-ethylsulfonylethylcarbamoylamino)-3-hydroxybutanoic acid (PubChem CID 114111684) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-(2-ethylsulfonylethylcarbamoylamino)-3-hydroxybutanoic acid.
| Compound Name | 2-(2-ethylsulfonylethylcarbamoylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114111684 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(2-ethylsulfonylethylcarbamoylamino)-3-hydroxybutanoic acid |
| SMILES | CCS(=O)(=O)CCNC(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C9H18N2O6S/c1-3-18(16,17)5-4-10-9(15)11-7(6(2)12)8(13)14/h6-7,12H,3-5H2,1-2H3,(H,13,14)(H2,10,11,15) |
| InChIKey | FUJOJFDNSMQNQD-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |