C9H17N3O5 — CID 61202444
2-(2-acetamidoethylcarbamoylamino)-3-hydroxybutanoic acid (PubChem CID 61202444) has the molecular formula C9H17N3O5 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(2-acetamidoethylcarbamoylamino)-3-hydroxybutanoic acid.
| Compound Name | 2-(2-acetamidoethylcarbamoylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61202444 |
| Molecular Formula | C9H17N3O5 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-(2-acetamidoethylcarbamoylamino)-3-hydroxybutanoic acid |
| SMILES | CC(=O)NCCNC(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C9H17N3O5/c1-5(13)7(8(15)16)12-9(17)11-4-3-10-6(2)14/h5,7,13H,3-4H2,1-2H3,(H,10,14)(H,15,16)(H2,11,12,17) |
| InChIKey | JDLHEUMUXAKRIA-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|