C8H17N3O6S — CID 104966135
(2S,3R)-3-hydroxy-2-(3-sulfamoylpropylcarbamoylamino)butanoic acid (PubChem CID 104966135) has the molecular formula C8H17N3O6S and a molecular weight of 283.31 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(3-sulfamoylpropylcarbamoylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(3-sulfamoylpropylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 104966135 |
| Molecular Formula | C8H17N3O6S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(3-sulfamoylpropylcarbamoylamino)butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)NCCCS(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C8H17N3O6S/c1-5(12)6(7(13)14)11-8(15)10-3-2-4-18(9,16)17/h5-6,12H,2-4H2,1H3,(H,13,14)(H2,9,16,17)(H2,10,11,15)/t5-,6+/m1/s1 |
| InChIKey | IFVGGMVGDYEIKK-RITPCOANSA-N |
| XLogP | -2.20 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|