C12H25N3O5S — CID 65287573
2-methyl-6-(3-sulfamoylpropylcarbamoylamino)heptanoic acid (PubChem CID 65287573) has the molecular formula C12H25N3O5S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-methyl-6-(3-sulfamoylpropylcarbamoylamino)heptanoic acid.
| Compound Name | 2-methyl-6-(3-sulfamoylpropylcarbamoylamino)heptanoic acid |
|---|---|
| PubChem CID | 65287573 |
| Molecular Formula | C12H25N3O5S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-methyl-6-(3-sulfamoylpropylcarbamoylamino)heptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NC(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C12H25N3O5S/c1-9(11(16)17)5-3-6-10(2)15-12(18)14-7-4-8-21(13,19)20/h9-10H,3-8H2,1-2H3,(H,16,17)(H2,13,19,20)(H2,14,15,18) |
| InChIKey | DLRCWPQHKBMPCV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|