C10H19N3O6S — CID 62965170
3-methyl-5-oxo-5-(3-sulfamoylpropylcarbamoylamino)pentanoic acid (PubChem CID 62965170) has the molecular formula C10H19N3O6S and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-methyl-5-oxo-5-(3-sulfamoylpropylcarbamoylamino)pentanoic acid.
| Compound Name | 3-methyl-5-oxo-5-(3-sulfamoylpropylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 62965170 |
| Molecular Formula | C10H19N3O6S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-methyl-5-oxo-5-(3-sulfamoylpropylcarbamoylamino)pentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)NC(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C10H19N3O6S/c1-7(6-9(15)16)5-8(14)13-10(17)12-3-2-4-20(11,18)19/h7H,2-6H2,1H3,(H,15,16)(H2,11,18,19)(H2,12,13,14,17) |
| InChIKey | SDBOLDUYAZBDSC-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|