C12H20N2O6 — CID 62965871
5-[(3-ethoxy-3-oxopropyl)carbamoylamino]-3-methyl-5-oxopentanoic acid (PubChem CID 62965871) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is 5-[(3-ethoxy-3-oxopropyl)carbamoylamino]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[(3-ethoxy-3-oxopropyl)carbamoylamino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62965871 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-[(3-ethoxy-3-oxopropyl)carbamoylamino]-3-methyl-5-oxopentanoic acid |
| SMILES | CCOC(=O)CCNC(=O)NC(=O)CC(C)CC(=O)O |
| InChI | InChI=1S/C12H20N2O6/c1-3-20-11(18)4-5-13-12(19)14-9(15)6-8(2)7-10(16)17/h8H,3-7H2,1-2H3,(H,16,17)(H2,13,14,15,19) |
| InChIKey | NRBGGAPFAXFEHU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |