C8H14N2O5 — CID 14949744
3-[(2-ethoxy-2-oxoethyl)carbamoylamino]propanoic acid (PubChem CID 14949744) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is 3-[(2-ethoxy-2-oxoethyl)carbamoylamino]propanoic acid.
| Compound Name | 3-[(2-ethoxy-2-oxoethyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 14949744 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-[(2-ethoxy-2-oxoethyl)carbamoylamino]propanoic acid |
| SMILES | CCOC(=O)CNC(=O)NCCC(=O)O |
| InChI | InChI=1S/C8H14N2O5/c1-2-15-7(13)5-10-8(14)9-4-3-6(11)12/h2-5H2,1H3,(H,11,12)(H2,9,10,14) |
| InChIKey | OPTRDIQWZSEWLB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |