C8H17N3O5S — CID 102676292
ethyl 2-[2-(methylsulfamoyl)ethylcarbamoylamino]acetate (PubChem CID 102676292) has the molecular formula C8H17N3O5S and a molecular weight of 267.31 g/mol. Its IUPAC name is ethyl 2-[2-(methylsulfamoyl)ethylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[2-(methylsulfamoyl)ethylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 102676292 |
| Molecular Formula | C8H17N3O5S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | ethyl 2-[2-(methylsulfamoyl)ethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCCS(=O)(=O)NC |
| InChI | InChI=1S/C8H17N3O5S/c1-3-16-7(12)6-11-8(13)10-4-5-17(14,15)9-2/h9H,3-6H2,1-2H3,(H2,10,11,13) |
| InChIKey | JNXUKYUDDHUWGP-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |