C13H18F3N3O4S — CID 118777029
1-[4-ethoxy-3-(trifluoromethyl)phenyl]-3-[2-(methylsulfamoyl)ethyl]urea (PubChem CID 118777029) has the molecular formula C13H18F3N3O4S and a molecular weight of 369.37 g/mol. Its IUPAC name is 1-[4-ethoxy-3-(trifluoromethyl)phenyl]-3-[2-(methylsulfamoyl)ethyl]urea.
| Compound Name | 1-[4-ethoxy-3-(trifluoromethyl)phenyl]-3-[2-(methylsulfamoyl)ethyl]urea |
|---|---|
| PubChem CID | 118777029 |
| Molecular Formula | C13H18F3N3O4S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1-[4-ethoxy-3-(trifluoromethyl)phenyl]-3-[2-(methylsulfamoyl)ethyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCCS(=O)(=O)NC)cc1C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O4S/c1-3-23-11-5-4-9(8-10(11)13(14,15)16)19-12(20)18-6-7-24(21,22)17-2/h4-5,8,17H,3,6-7H2,1-2H3,(H2,18,19,20) |
| InChIKey | RDHZBRSHRRSVBB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |