C9H9F3O4S — CID 174921515
4-ethoxy-3-(trifluoromethyl)benzenesulfonic acid (PubChem CID 174921515) has the molecular formula C9H9F3O4S and a molecular weight of 270.23 g/mol. Its IUPAC name is 4-ethoxy-3-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 4-ethoxy-3-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 174921515 |
| Molecular Formula | C9H9F3O4S |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 4-ethoxy-3-(trifluoromethyl)benzenesulfonic acid |
| SMILES | CCOc1ccc(S(=O)(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H9F3O4S/c1-2-16-8-4-3-6(17(13,14)15)5-7(8)9(10,11)12/h3-5H,2H2,1H3,(H,13,14,15) |
| InChIKey | VYQHAWGBRCJSMN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|