C10H13NO5S — CID 82483875
3-acetamido-4-ethoxybenzenesulfonic acid (PubChem CID 82483875) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 3-acetamido-4-ethoxybenzenesulfonic acid.
| Compound Name | 3-acetamido-4-ethoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 82483875 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-acetamido-4-ethoxybenzenesulfonic acid |
| SMILES | CCOc1ccc(S(=O)(=O)O)cc1NC(C)=O |
| InChI | InChI=1S/C10H13NO5S/c1-3-16-10-5-4-8(17(13,14)15)6-9(10)11-7(2)12/h4-6H,3H2,1-2H3,(H,11,12)(H,13,14,15) |
| InChIKey | YGYLUVHSPUVEAR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|