About carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride
carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride (PubChem CID 160634614) has the molecular formula C10H8ClF3O5S
and a molecular weight of 332.68 g/mol. Its IUPAC name is carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride.
Molecular Properties
| Compound Name | carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride |
| PubChem CID | 160634614 |
| Molecular Formula | C10H8ClF3O5S |
| Molecular Weight | 332.68 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride |
| SMILES | CCOc1ccc(S(=O)(=O)Cl)cc1C(F)(F)F.O=C=O |
| InChI | InChI=1S/C9H8ClF3O3S.CO2/c1-2-16-8-4-3-6(17(10,14)15)5-7(8)9(11,12)13;2-1-3/h3-5H,2H2,1H3; |
| InChIKey | RIJJRIHJMSQHTI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride?
The IUPAC name of carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride (CID 160634614) is carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride.
What is the SMILES notation for carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride?
The canonical SMILES for carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride is CCOc1ccc(S(=O)(=O)Cl)cc1C(F)(F)F.O=C=O.
What is the InChIKey of carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride?
The InChIKey is RIJJRIHJMSQHTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF3O3S.CO2/c1-2-16-8-4-3-6(17(10,14)15)5-7(8)9(11,12)13;2-1-3/h3-5H,2H2,1H3;.
What are the key properties of carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride?
carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride has a molecular weight of 332.68 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride is sourced from PubChem (CID 160634614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).