carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride

C10H8ClF3O5S — CID 160634614

IUPACcarbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride
SMILESCCOc1ccc(S(=O)(=O)Cl)cc1C(F)(F)F.O=C=O
InChIInChI=1S/C9H8ClF3O3S.CO2/c1-2-16-8-4-3-6(17(10,14)15)5-7(8)9(11,12)13;2-1-3/h3-5H,2H2,1H3;
InChIKeyRIJJRIHJMSQHTI-UHFFFAOYSA-N
MW332.68 g/mol
LogP2.45
Rot. Bonds3

About carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride

carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride (PubChem CID 160634614) has the molecular formula C10H8ClF3O5S and a molecular weight of 332.68 g/mol. Its IUPAC name is carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride.

Molecular Properties

Compound Namecarbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride
PubChem CID160634614
Molecular FormulaC10H8ClF3O5S
Molecular Weight332.68 g/mol
Exact Mass331.97
IUPAC Namecarbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride
SMILESCCOc1ccc(S(=O)(=O)Cl)cc1C(F)(F)F.O=C=O
InChIInChI=1S/C9H8ClF3O3S.CO2/c1-2-16-8-4-3-6(17(10,14)15)5-7(8)9(11,12)13;2-1-3/h3-5H,2H2,1H3;
InChIKeyRIJJRIHJMSQHTI-UHFFFAOYSA-N
XLogP2.45
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.68
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride?
The IUPAC name of carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride (CID 160634614) is carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride.
What is the SMILES notation for carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride?
The canonical SMILES for carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride is CCOc1ccc(S(=O)(=O)Cl)cc1C(F)(F)F.O=C=O.
What is the InChIKey of carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride?
The InChIKey is RIJJRIHJMSQHTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF3O3S.CO2/c1-2-16-8-4-3-6(17(10,14)15)5-7(8)9(11,12)13;2-1-3/h3-5H,2H2,1H3;.
What are the key properties of carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride?
carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride has a molecular weight of 332.68 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-ethoxy-3-(trifluoromethyl)benzenesulfonyl chloride is sourced from PubChem (CID 160634614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).