C11H10ClF3O5S — CID 150632807
methyl 3-[4-chlorosulfonyl-2-(trifluoromethyl)phenoxy]propanoate (PubChem CID 150632807) has the molecular formula C11H10ClF3O5S and a molecular weight of 346.71 g/mol. Its IUPAC name is methyl 3-[4-chlorosulfonyl-2-(trifluoromethyl)phenoxy]propanoate.
| Compound Name | methyl 3-[4-chlorosulfonyl-2-(trifluoromethyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 150632807 |
| Molecular Formula | C11H10ClF3O5S |
| Molecular Weight | 346.71 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | methyl 3-[4-chlorosulfonyl-2-(trifluoromethyl)phenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(S(=O)(=O)Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10ClF3O5S/c1-19-10(16)4-5-20-9-3-2-7(21(12,17)18)6-8(9)11(13,14)15/h2-3,6H,4-5H2,1H3 |
| InChIKey | IYGCSBFZGXMKKV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |