C13H16F3NO5S — CID 171484135
N-methoxy-N-methyl-4-(2-methylsulfonylethoxy)-3-(trifluoromethyl)benzamide (PubChem CID 171484135) has the molecular formula C13H16F3NO5S and a molecular weight of 355.33 g/mol. Its IUPAC name is N-methoxy-N-methyl-4-(2-methylsulfonylethoxy)-3-(trifluoromethyl)benzamide.
| Compound Name | N-methoxy-N-methyl-4-(2-methylsulfonylethoxy)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171484135 |
| Molecular Formula | C13H16F3NO5S |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-methoxy-N-methyl-4-(2-methylsulfonylethoxy)-3-(trifluoromethyl)benzamide |
| SMILES | CON(C)C(=O)c1ccc(OCCS(C)(=O)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO5S/c1-17(21-2)12(18)9-4-5-11(10(8-9)13(14,15)16)22-6-7-23(3,19)20/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | BSFFLPYXGUYNRI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|