C11H13F3O4S — CID 63320226
[4-(2-methylsulfonylethoxy)-3-(trifluoromethyl)phenyl]methanol (PubChem CID 63320226) has the molecular formula C11H13F3O4S and a molecular weight of 298.28 g/mol. Its IUPAC name is [4-(2-methylsulfonylethoxy)-3-(trifluoromethyl)phenyl]methanol.
| Compound Name | [4-(2-methylsulfonylethoxy)-3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 63320226 |
| Molecular Formula | C11H13F3O4S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | [4-(2-methylsulfonylethoxy)-3-(trifluoromethyl)phenyl]methanol |
| SMILES | CS(=O)(=O)CCOc1ccc(CO)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3O4S/c1-19(16,17)5-4-18-10-3-2-8(7-15)6-9(10)11(12,13)14/h2-3,6,15H,4-5,7H2,1H3 |
| InChIKey | RPSGIEWXXGHALA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |