C12H12F6O3 — CID 63320753
[4-[2-(2,2,2-trifluoroethoxy)ethoxy]-3-(trifluoromethyl)phenyl]methanol (PubChem CID 63320753) has the molecular formula C12H12F6O3 and a molecular weight of 318.21 g/mol. Its IUPAC name is [4-[2-(2,2,2-trifluoroethoxy)ethoxy]-3-(trifluoromethyl)phenyl]methanol.
| Compound Name | [4-[2-(2,2,2-trifluoroethoxy)ethoxy]-3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 63320753 |
| Molecular Formula | C12H12F6O3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [4-[2-(2,2,2-trifluoroethoxy)ethoxy]-3-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1ccc(OCCOCC(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6O3/c13-11(14,15)7-20-3-4-21-10-2-1-8(6-19)5-9(10)12(16,17)18/h1-2,5,19H,3-4,6-7H2 |
| InChIKey | FHVDKPCQANNYAD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|