C10H10F4O3 — CID 107690662
[3-fluoro-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methanol (PubChem CID 107690662) has the molecular formula C10H10F4O3 and a molecular weight of 254.18 g/mol. Its IUPAC name is [3-fluoro-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methanol.
| Compound Name | [3-fluoro-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107690662 |
| Molecular Formula | C10H10F4O3 |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | [3-fluoro-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methanol |
| SMILES | OCc1ccc(OCOCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C10H10F4O3/c11-8-3-7(4-15)1-2-9(8)17-6-16-5-10(12,13)14/h1-3,15H,4-6H2 |
| InChIKey | JCYPHOBOEKWGCH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|