C10H9ClF4O2 — CID 107691406
4-(chloromethyl)-2-fluoro-1-(2,2,2-trifluoroethoxymethoxy)benzene (PubChem CID 107691406) has the molecular formula C10H9ClF4O2 and a molecular weight of 272.63 g/mol. Its IUPAC name is 4-(chloromethyl)-2-fluoro-1-(2,2,2-trifluoroethoxymethoxy)benzene.
| Compound Name | 4-(chloromethyl)-2-fluoro-1-(2,2,2-trifluoroethoxymethoxy)benzene |
|---|---|
| PubChem CID | 107691406 |
| Molecular Formula | C10H9ClF4O2 |
| Molecular Weight | 272.63 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 4-(chloromethyl)-2-fluoro-1-(2,2,2-trifluoroethoxymethoxy)benzene |
| SMILES | Fc1cc(CCl)ccc1OCOCC(F)(F)F |
| InChI | InChI=1S/C10H9ClF4O2/c11-4-7-1-2-9(8(12)3-7)17-6-16-5-10(13,14)15/h1-3H,4-6H2 |
| InChIKey | PKLRUYMKYAQSQS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|