C11H10F6O3 — CID 106705149
[4-(2,2,2-trifluoroethoxymethoxy)-3-(trifluoromethyl)phenyl]methanol (PubChem CID 106705149) has the molecular formula C11H10F6O3 and a molecular weight of 304.19 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxymethoxy)-3-(trifluoromethyl)phenyl]methanol.
| Compound Name | [4-(2,2,2-trifluoroethoxymethoxy)-3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 106705149 |
| Molecular Formula | C11H10F6O3 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxymethoxy)-3-(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1ccc(OCOCC(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F6O3/c12-10(13,14)5-19-6-20-9-2-1-7(4-18)3-8(9)11(15,16)17/h1-3,18H,4-6H2 |
| InChIKey | ALFNRUCSEZVAJF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|