C10H7BrF6O — CID 55204720
4-(bromomethyl)-1-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)benzene (PubChem CID 55204720) has the molecular formula C10H7BrF6O and a molecular weight of 337.06 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)benzene.
| Compound Name | 4-(bromomethyl)-1-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 55204720 |
| Molecular Formula | C10H7BrF6O |
| Molecular Weight | 337.06 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 4-(bromomethyl)-1-(2,2,2-trifluoroethoxy)-2-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)COc1ccc(CBr)cc1C(F)(F)F |
| InChI | InChI=1S/C10H7BrF6O/c11-4-6-1-2-8(18-5-9(12,13)14)7(3-6)10(15,16)17/h1-3H,4-5H2 |
| InChIKey | BLGPKNYSPWSBAB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.06 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|