C9H6F6O2 — CID 166611037
4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)phenol (PubChem CID 166611037) has the molecular formula C9H6F6O2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)phenol.
| Compound Name | 4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 166611037 |
| Molecular Formula | C9H6F6O2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(OCC(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F6O2/c10-8(11,12)4-17-7-2-1-5(16)3-6(7)9(13,14)15/h1-3,16H,4H2 |
| InChIKey | XQAKNMNQKSYYFO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |