C9H7BF6O3 — CID 88588290
[4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)phenyl]boronic acid (PubChem CID 88588290) has the molecular formula C9H7BF6O3 and a molecular weight of 287.95 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | [4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 88588290 |
| Molecular Formula | C9H7BF6O3 |
| Molecular Weight | 287.95 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(OCC(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7BF6O3/c11-8(12,13)4-19-7-2-1-5(10(17)18)3-6(7)9(14,15)16/h1-3,17-18H,4H2 |
| InChIKey | URCDPDANUDVTKI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.95 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|