C11H7F9O3 — CID 166738236
3-[2,4-bis(trifluoromethyl)phenoxy]-1,1,1-trifluoropropane-2,2-diol (PubChem CID 166738236) has the molecular formula C11H7F9O3 and a molecular weight of 358.16 g/mol. Its IUPAC name is 3-[2,4-bis(trifluoromethyl)phenoxy]-1,1,1-trifluoropropane-2,2-diol.
| Compound Name | 3-[2,4-bis(trifluoromethyl)phenoxy]-1,1,1-trifluoropropane-2,2-diol |
|---|---|
| PubChem CID | 166738236 |
| Molecular Formula | C11H7F9O3 |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3-[2,4-bis(trifluoromethyl)phenoxy]-1,1,1-trifluoropropane-2,2-diol |
| SMILES | OC(O)(COc1ccc(C(F)(F)F)cc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H7F9O3/c12-9(13,14)5-1-2-7(6(3-5)10(15,16)17)23-4-8(21,22)11(18,19)20/h1-3,21-22H,4H2 |
| InChIKey | QWLYEAWPTFZENF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|