C11H9BF3NO3 — CID 140913382
[2-(2,2,2-trifluoroethoxy)quinolin-6-yl]boronic acid (PubChem CID 140913382) has the molecular formula C11H9BF3NO3 and a molecular weight of 271.00 g/mol. Its IUPAC name is [2-(2,2,2-trifluoroethoxy)quinolin-6-yl]boronic acid.
| Compound Name | [2-(2,2,2-trifluoroethoxy)quinolin-6-yl]boronic acid |
|---|---|
| PubChem CID | 140913382 |
| Molecular Formula | C11H9BF3NO3 |
| Molecular Weight | 271.00 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | [2-(2,2,2-trifluoroethoxy)quinolin-6-yl]boronic acid |
| SMILES | OB(O)c1ccc2nc(OCC(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C11H9BF3NO3/c13-11(14,15)6-19-10-4-1-7-5-8(12(17)18)2-3-9(7)16-10/h1-5,17-18H,6H2 |
| InChIKey | ULPDFWOSACNHLY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.00 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|