C8H5ClF3NO3 — CID 87426689
2-chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid (PubChem CID 87426689) has the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. Its IUPAC name is 2-chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid.
| Compound Name | 2-chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 87426689 |
| Molecular Formula | C8H5ClF3NO3 |
| Molecular Weight | 255.58 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 2-chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(OCC(F)(F)F)nc1Cl |
| InChI | InChI=1S/C8H5ClF3NO3/c9-6-4(7(14)15)1-2-5(13-6)16-3-8(10,11)12/h1-2H,3H2,(H,14,15) |
| InChIKey | DIZGVIDKUUXBIJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|