C14H8Cl2F6N2O3 — CID 157313543
2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid;[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol (PubChem CID 157313543) has the molecular formula C14H8Cl2F6N2O3 and a molecular weight of 437.12 g/mol. Its IUPAC name is 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid;[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol.
| Compound Name | 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid;[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 157313543 |
| Molecular Formula | C14H8Cl2F6N2O3 |
| Molecular Weight | 437.12 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylic acid;[2-chloro-6-(trifluoromethyl)-3-pyridinyl]methanol |
| SMILES | O=C(O)c1ccc(C(F)(F)F)nc1Cl.OCc1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C7H3ClF3NO2.C7H5ClF3NO/c8-5-3(6(13)14)1-2-4(12-5)7(9,10)11;8-6-4(3-13)1-2-5(12-6)7(9,10)11/h1-2H,(H,13,14);1-2,13H,3H2 |
| InChIKey | BDHYEAPSNWWVHD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.12 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|