C16H9ClF6N2O2 — CID 159877906
1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-4-[2-(trifluoromethyl)-3-pyridinyl]butane-1,3-dione (PubChem CID 159877906) has the molecular formula C16H9ClF6N2O2 and a molecular weight of 410.70 g/mol. Its IUPAC name is 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-4-[2-(trifluoromethyl)-3-pyridinyl]butane-1,3-dione.
| Compound Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-4-[2-(trifluoromethyl)-3-pyridinyl]butane-1,3-dione |
|---|---|
| PubChem CID | 159877906 |
| Molecular Formula | C16H9ClF6N2O2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-4-[2-(trifluoromethyl)-3-pyridinyl]butane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccc(C(F)(F)F)nc1Cl)Cc1cccnc1C(F)(F)F |
| InChI | InChI=1S/C16H9ClF6N2O2/c17-14-10(3-4-12(25-14)15(18,19)20)11(27)7-9(26)6-8-2-1-5-24-13(8)16(21,22)23/h1-5H,6-7H2 |
| InChIKey | NTDLCQSGIRQLAR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|