C12H13ClF3NO2 — CID 106971871
1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-4-methoxypentan-1-one (PubChem CID 106971871) has the molecular formula C12H13ClF3NO2 and a molecular weight of 295.69 g/mol. Its IUPAC name is 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-4-methoxypentan-1-one.
| Compound Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-4-methoxypentan-1-one |
|---|---|
| PubChem CID | 106971871 |
| Molecular Formula | C12H13ClF3NO2 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-4-methoxypentan-1-one |
| SMILES | COC(C)CCC(=O)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C12H13ClF3NO2/c1-7(19-2)3-5-9(18)8-4-6-10(12(14,15)16)17-11(8)13/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | VMUMFVYZCQPYMT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|