C8H5F3N2O5 — CID 114089663
5-nitro-2-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid (PubChem CID 114089663) has the molecular formula C8H5F3N2O5 and a molecular weight of 266.13 g/mol. Its IUPAC name is 5-nitro-2-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid.
| Compound Name | 5-nitro-2-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114089663 |
| Molecular Formula | C8H5F3N2O5 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 5-nitro-2-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(OCC(F)(F)F)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5F3N2O5/c9-8(10,11)3-18-6-1-4(7(14)15)5(2-12-6)13(16)17/h1-2H,3H2,(H,14,15) |
| InChIKey | XINMGPRBQFIHNM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|