C19H16F6N4O4 — CID 24603441
[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone (PubChem CID 24603441) has the molecular formula C19H16F6N4O4 and a molecular weight of 478.35 g/mol. Its IUPAC name is [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone.
| Compound Name | [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 24603441 |
| Molecular Formula | C19H16F6N4O4 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(OCC(F)(F)F)nc1)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H16F6N4O4/c20-18(21,22)11-33-16-4-1-12(10-26-16)17(30)28-7-5-27(6-8-28)14-3-2-13(19(23,24)25)9-15(14)29(31)32/h1-4,9-10H,5-8,11H2 |
| InChIKey | LNALWUJBWSDUSR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|