C20H19BrF3N3O4 — CID 23100243
(3-bromo-4-ethoxyphenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 23100243) has the molecular formula C20H19BrF3N3O4 and a molecular weight of 502.29 g/mol. Its IUPAC name is (3-bromo-4-ethoxyphenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (3-bromo-4-ethoxyphenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 23100243 |
| Molecular Formula | C20H19BrF3N3O4 |
| Molecular Weight | 502.29 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | (3-bromo-4-ethoxyphenyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CCN(c3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)cc1Br |
| InChI | InChI=1S/C20H19BrF3N3O4/c1-2-31-18-6-3-13(11-15(18)21)19(28)26-9-7-25(8-10-26)16-5-4-14(20(22,23)24)12-17(16)27(29)30/h3-6,11-12H,2,7-10H2,1H3 |
| InChIKey | XBRWMHCJZGUGGE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|