C20H20BrF3N2O2 — CID 2067330
3-bromo-4-ethoxy-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 2067330) has the molecular formula C20H20BrF3N2O2 and a molecular weight of 457.29 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2067330 |
| Molecular Formula | C20H20BrF3N2O2 |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2N2CCCC2)cc1Br |
| InChI | InChI=1S/C20H20BrF3N2O2/c1-2-28-18-8-5-13(11-15(18)21)19(27)25-16-12-14(20(22,23)24)6-7-17(16)26-9-3-4-10-26/h5-8,11-12H,2-4,9-10H2,1H3,(H,25,27) |
| InChIKey | POFDZTCASYOGHF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |