C20H24Cl2F3N3O — CID 119828240
4-(aminomethyl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide;dihydrochloride (PubChem CID 119828240) has the molecular formula C20H24Cl2F3N3O and a molecular weight of 450.33 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119828240 |
| Molecular Formula | C20H24Cl2F3N3O |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 4-(aminomethyl)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide;dihydrochloride |
| SMILES | Cl.Cl.NCc1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O.2ClH/c21-20(22,23)16-8-9-18(26-10-2-1-3-11-26)17(12-16)25-19(27)15-6-4-14(13-24)5-7-15;;/h4-9,12H,1-3,10-11,13,24H2,(H,25,27);2*1H |
| InChIKey | ONVHHPXQTJQLGX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |