C15H22Cl2F3N3O — CID 119828236
2-(methylamino)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide;dihydrochloride (PubChem CID 119828236) has the molecular formula C15H22Cl2F3N3O and a molecular weight of 388.26 g/mol. Its IUPAC name is 2-(methylamino)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide;dihydrochloride.
| Compound Name | 2-(methylamino)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119828236 |
| Molecular Formula | C15H22Cl2F3N3O |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-(methylamino)-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]acetamide;dihydrochloride |
| SMILES | CNCC(=O)Nc1cc(C(F)(F)F)ccc1N1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C15H20F3N3O.2ClH/c1-19-10-14(22)20-12-9-11(15(16,17)18)5-6-13(12)21-7-3-2-4-8-21;;/h5-6,9,19H,2-4,7-8,10H2,1H3,(H,20,22);2*1H |
| InChIKey | AHMKBMVTCFYFSO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |