C16H19F3N2O3 — CID 108808751
methyl 4-oxo-4-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]butanoate (PubChem CID 108808751) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is methyl 4-oxo-4-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]butanoate.
| Compound Name | methyl 4-oxo-4-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]butanoate |
|---|---|
| PubChem CID | 108808751 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 4-oxo-4-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]butanoate |
| SMILES | COC(=O)CCC(=O)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C16H19F3N2O3/c1-24-15(23)7-6-14(22)20-12-10-11(16(17,18)19)4-5-13(12)21-8-2-3-9-21/h4-5,10H,2-3,6-9H2,1H3,(H,20,22) |
| InChIKey | JANNRWJWSDHJGH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |