C18H21F3N2O4 — CID 9199101
[2-oxo-2-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]ethyl] 4-oxopentanoate (PubChem CID 9199101) has the molecular formula C18H21F3N2O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is [2-oxo-2-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]ethyl] 4-oxopentanoate.
| Compound Name | [2-oxo-2-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]ethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 9199101 |
| Molecular Formula | C18H21F3N2O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [2-oxo-2-[2-pyrrolidin-1-yl-5-(trifluoromethyl)anilino]ethyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C18H21F3N2O4/c1-12(24)4-7-17(26)27-11-16(25)22-14-10-13(18(19,20)21)5-6-15(14)23-8-2-3-9-23/h5-6,10H,2-4,7-9,11H2,1H3,(H,22,25) |
| InChIKey | HKHZSQJRKKILPV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |