C16H19F3N2O5 — CID 7669566
[2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxyacetate (PubChem CID 7669566) has the molecular formula C16H19F3N2O5 and a molecular weight of 376.33 g/mol. Its IUPAC name is [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 7669566 |
| Molecular Formula | C16H19F3N2O5 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C16H19F3N2O5/c1-24-10-15(23)26-9-14(22)20-12-8-11(16(17,18)19)2-3-13(12)21-4-6-25-7-5-21/h2-3,8H,4-7,9-10H2,1H3,(H,20,22) |
| InChIKey | LORMJZGOKFBGDR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |