C18H16BrF3N2O5 — CID 4855837
[2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 4855837) has the molecular formula C18H16BrF3N2O5 and a molecular weight of 477.23 g/mol. Its IUPAC name is [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
| Compound Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 4855837 |
| Molecular Formula | C18H16BrF3N2O5 |
| Molecular Weight | 477.23 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(Br)o1)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C18H16BrF3N2O5/c19-15-4-3-14(29-15)17(26)28-10-16(25)23-12-9-11(18(20,21)22)1-2-13(12)24-5-7-27-8-6-24/h1-4,9H,5-8,10H2,(H,23,25) |
| InChIKey | YDYXKJYHWLELMJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |