C23H20F3N3O6 — CID 42983757
[2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42983757) has the molecular formula C23H20F3N3O6 and a molecular weight of 491.42 g/mol. Its IUPAC name is [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42983757 |
| Molecular Formula | C23H20F3N3O6 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CN1C(=O)c2ccc(C(=O)OCC(=O)Nc3cc(C(F)(F)F)ccc3N3CCOCC3)cc2C1=O |
| InChI | InChI=1S/C23H20F3N3O6/c1-28-20(31)15-4-2-13(10-16(15)21(28)32)22(33)35-12-19(30)27-17-11-14(23(24,25)26)3-5-18(17)29-6-8-34-9-7-29/h2-5,10-11H,6-9,12H2,1H3,(H,27,30) |
| InChIKey | GPZHQENRDXRYQX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|