C24H21F3N2O4 — CID 2437347
[2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] naphthalene-1-carboxylate (PubChem CID 2437347) has the molecular formula C24H21F3N2O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] naphthalene-1-carboxylate.
| Compound Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 2437347 |
| Molecular Formula | C24H21F3N2O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] naphthalene-1-carboxylate |
| SMILES | O=C(COC(=O)c1cccc2ccccc12)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H21F3N2O4/c25-24(26,27)17-8-9-21(29-10-12-32-13-11-29)20(14-17)28-22(30)15-33-23(31)19-7-3-5-16-4-1-2-6-18(16)19/h1-9,14H,10-13,15H2,(H,28,30) |
| InChIKey | OGADFGPXQGEVDZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |