C20H19F4N3O4 — CID 27997827
[2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 27997827) has the molecular formula C20H19F4N3O4 and a molecular weight of 441.38 g/mol. Its IUPAC name is [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 27997827 |
| Molecular Formula | C20H19F4N3O4 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | Nc1cc(F)ccc1C(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H19F4N3O4/c21-13-2-3-14(15(25)10-13)19(29)31-11-18(28)26-16-9-12(20(22,23)24)1-4-17(16)27-5-7-30-8-6-27/h1-4,9-10H,5-8,11,25H2,(H,26,28) |
| InChIKey | RLUBPSQEJJWVOE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|